C16H31IN6O2 — CID 111896020
1-(2-ethoxyethyl)-3-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111896020) has the molecular formula C16H31IN6O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2-ethoxyethyl)-3-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111896020 |
| Molecular Formula | C16H31IN6O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)NCCOCC.I |
| InChI | InChI=1S/C16H30N6O2.HI/c1-3-17-15(19-10-13-24-4-2)18-9-7-12-22-16(23)21-11-6-5-8-14(21)20-22;/h3-13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | LUNPNJMMJUHBMH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|