C21H34FN5OS — CID 111311056
1-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 111311056) has the molecular formula C21H34FN5OS and a molecular weight of 423.60 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111311056 |
| Molecular Formula | C21H34FN5OS |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\CCCSc1ccc(F)cc1)NCCCN1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C21H34FN5OS/c1-2-24-21(26-12-5-15-29-19-9-7-18(22)8-10-19)25-11-4-14-27-13-3-6-17(16-27)20(23)28/h7-10,17H,2-6,11-16H2,1H3,(H2,23,28)(H2,24,25,26) |
| InChIKey | NNJWYWCTXCUHJK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|