C24H40N6O — CID 110986288
1-[3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide (PubChem CID 110986288) has the molecular formula C24H40N6O and a molecular weight of 428.63 g/mol. Its IUPAC name is 1-[3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110986288 |
| Molecular Formula | C24H40N6O |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 1-[3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\CCCN1CCCC(C(N)=O)C1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H40N6O/c1-2-26-24(27-13-7-15-29-14-6-10-21(19-29)23(25)31)28-22-11-16-30(17-12-22)18-20-8-4-3-5-9-20/h3-5,8-9,21-22H,2,6-7,10-19H2,1H3,(H2,25,31)(H2,26,27,28) |
| InChIKey | DPIRGSYBPASLKU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|