C25H39N7 — CID 110986358
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine (PubChem CID 110986358) has the molecular formula C25H39N7 and a molecular weight of 437.64 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 110986358 |
| Molecular Formula | C25H39N7 |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc2n1CCCCC2)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H39N7/c1-2-26-25(27-16-9-13-24-30-29-23-12-7-4-8-17-32(23)24)28-22-14-18-31(19-15-22)20-21-10-5-3-6-11-21/h3,5-6,10-11,22H,2,4,7-9,12-20H2,1H3,(H2,26,27,28) |
| InChIKey | OBTJWGKASDSMPT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|