C23H38N6O — CID 110986286
1-[3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 110986286) has the molecular formula C23H38N6O and a molecular weight of 414.60 g/mol. Its IUPAC name is 1-[3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110986286 |
| Molecular Formula | C23H38N6O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 1-[3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | C/N=C(\NCCCN1CCCC(C(N)=O)C1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H38N6O/c1-25-23(26-12-6-14-28-13-5-9-20(18-28)22(24)30)27-21-10-15-29(16-11-21)17-19-7-3-2-4-8-19/h2-4,7-8,20-21H,5-6,9-18H2,1H3,(H2,24,30)(H2,25,26,27) |
| InChIKey | URMPOKBNAQFOAM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|