C22H36N6O — CID 111923849
1-[3-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 111923849) has the molecular formula C22H36N6O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[3-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111923849 |
| Molecular Formula | C22H36N6O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 1-[3-[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | C/N=C(\NCCCN1CCCC(C(N)=O)C1)NC1CCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H36N6O/c1-17-6-8-20(9-7-17)28-14-10-19(16-28)26-22(24-2)25-11-4-13-27-12-3-5-18(15-27)21(23)29/h6-9,18-19H,3-5,10-16H2,1-2H3,(H2,23,29)(H2,24,25,26) |
| InChIKey | SOUXPXYPXTYGTO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|