C19H31N5O — CID 111359170
1-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 111359170) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111359170 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 1-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | C/N=C(/NCCCN1CCCC(C(N)=O)C1)NCc1ccccc1C |
| InChI | InChI=1S/C19H31N5O/c1-15-7-3-4-8-16(15)13-23-19(21-2)22-10-6-12-24-11-5-9-17(14-24)18(20)25/h3-4,7-8,17H,5-6,9-14H2,1-2H3,(H2,20,25)(H2,21,22,23) |
| InChIKey | HZRQJLKLYYPVJX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|