C19H30F2IN5O2 — CID 111865539
1-[3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111865539) has the molecular formula C19H30F2IN5O2 and a molecular weight of 525.38 g/mol. Its IUPAC name is 1-[3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111865539 |
| Molecular Formula | C19H30F2IN5O2 |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1-[3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCC(C(N)=O)C1)NCc1ccccc1OC(F)F.I |
| InChI | InChI=1S/C19H29F2N5O2.HI/c1-23-19(25-12-14-6-2-3-8-16(14)28-18(20)21)24-9-5-11-26-10-4-7-15(13-26)17(22)27;/h2-3,6,8,15,18H,4-5,7,9-13H2,1H3,(H2,22,27)(H2,23,24,25);1H |
| InChIKey | LBUUZXYIBHQOBW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|