C17H32IN7O — CID 111510304
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111510304) has the molecular formula C17H32IN7O and a molecular weight of 477.40 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111510304 |
| Molecular Formula | C17H32IN7O |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\CC(C)N1CCOCC1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C17H31N7O.HI/c1-4-6-18-17(19-7-8-24-14-21-22-16(24)5-2)20-13-15(3)23-9-11-25-12-10-23;/h4,14-15H,1,5-13H2,2-3H3,(H2,18,19,20);1H |
| InChIKey | MPDXERRGZZSRLX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|