C22H44IN7O — CID 111510314
2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111510314) has the molecular formula C22H44IN7O and a molecular weight of 549.55 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111510314 |
| Molecular Formula | C22H44IN7O |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCCCC(CC)C/N=C(\NCCn1cnnc1CC)NCC(C)N1CCOCC1.I |
| InChI | InChI=1S/C22H43N7O.HI/c1-5-8-9-20(6-2)17-25-22(23-10-11-29-18-26-27-21(29)7-3)24-16-19(4)28-12-14-30-15-13-28;/h18-20H,5-17H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | SWDFFGGJXKYACQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|