C18H38IN7O2S — CID 111698419
2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide (PubChem CID 111698419) has the molecular formula C18H38IN7O2S and a molecular weight of 543.52 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111698419 |
| Molecular Formula | C18H38IN7O2S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 2-(2-ethylhexyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide |
| SMILES | CCCCC(CC)C/N=C(\NCCNS(C)(=O)=O)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C18H37N7O2S.HI/c1-5-8-9-16(6-2)14-21-18(19-10-11-23-28(4,26)27)20-12-13-25-15-22-24-17(25)7-3;/h15-16,23H,5-14H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | FRJFNMOOPVTARE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|