C23H45N7O — CID 111515262
1-(2-ethylhexyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111515262) has the molecular formula C23H45N7O and a molecular weight of 435.66 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-(2-ethylhexyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111515262 |
| Molecular Formula | C23H45N7O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.37 |
| IUPAC Name | 1-(2-ethylhexyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCCCC(CC)CN/C(=N/CC(C)(C)N1CCOCC1)NCCn1cnnc1CC |
| InChI | InChI=1S/C23H45N7O/c1-6-9-10-20(7-2)17-25-22(24-11-12-29-19-27-28-21(29)8-3)26-18-23(4,5)30-13-15-31-16-14-30/h19-20H,6-18H2,1-5H3,(H2,24,25,26) |
| InChIKey | LGNJFFQBBYSPTA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|