C22H36IN7O — CID 111515237
2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111515237) has the molecular formula C22H36IN7O and a molecular weight of 541.48 g/mol. Its IUPAC name is 2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515237 |
| Molecular Formula | C22H36IN7O |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\Cc1ccccc1)NCC(C)(C)N1CCOCC1.I |
| InChI | InChI=1S/C22H35N7O.HI/c1-4-20-27-26-18-28(20)11-10-23-21(24-16-19-8-6-5-7-9-19)25-17-22(2,3)29-12-14-30-15-13-29;/h5-9,18H,4,10-17H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | UEESPFMMXKNHJP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|