C22H35N7O2 — CID 111513404
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(3-methoxyphenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111513404) has the molecular formula C22H35N7O2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(3-methoxyphenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(3-methoxyphenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111513404 |
| Molecular Formula | C22H35N7O2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[(3-methoxyphenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N/Cc1cccc(OC)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C22H35N7O2/c1-3-21-27-26-18-29(21)11-9-24-22(23-8-5-10-28-12-14-31-15-13-28)25-17-19-6-4-7-20(16-19)30-2/h4,6-7,16,18H,3,5,8-15,17H2,1-2H3,(H2,23,24,25) |
| InChIKey | RABJSVNGUMVJRJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|