C22H39N9O — CID 111514122
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111514122) has the molecular formula C22H39N9O and a molecular weight of 445.62 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111514122 |
| Molecular Formula | C22H39N9O |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\CCCn1nc(C)cc1C)NCCCN1CCOCC1 |
| InChI | InChI=1S/C22H39N9O/c1-4-21-27-26-18-30(21)12-9-25-22(23-7-5-10-29-13-15-32-16-14-29)24-8-6-11-31-20(3)17-19(2)28-31/h17-18H,4-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | CKRCPFVODYFSLJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|