C22H35FIN7O — CID 111517084
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111517084) has the molecular formula C22H35FIN7O and a molecular weight of 559.47 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111517084 |
| Molecular Formula | C22H35FIN7O |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CCCN1CCOCC1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C22H34FN7O.HI/c1-2-21-28-27-18-30(21)13-11-26-22(24-9-5-12-29-14-16-31-17-15-29)25-10-8-19-6-3-4-7-20(19)23;/h3-4,6-7,18H,2,5,8-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | QPXBKBFFSIMBRS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|