C22H34F2IN7O — CID 111516006
1-[1-(3,4-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111516006) has the molecular formula C22H34F2IN7O and a molecular weight of 577.46 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111516006 |
| Molecular Formula | C22H34F2IN7O |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CCCN1CCOCC1)NC(C)c1ccc(F)c(F)c1.I |
| InChI | InChI=1S/C22H33F2N7O.HI/c1-3-21-29-27-16-31(21)10-8-26-22(25-7-4-9-30-11-13-32-14-12-30)28-17(2)18-5-6-19(23)20(24)15-18;/h5-6,15-17H,3-4,7-14H2,1-2H3,(H2,25,26,28);1H |
| InChIKey | BZOLVSOHLPSMKZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|