C22H41N7O — CID 111518861
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-methylpiperidin-1-yl)propyl]-3-[1-(oxolan-2-yl)ethyl]guanidine (PubChem CID 111518861) has the molecular formula C22H41N7O and a molecular weight of 419.62 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-methylpiperidin-1-yl)propyl]-3-[1-(oxolan-2-yl)ethyl]guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-methylpiperidin-1-yl)propyl]-3-[1-(oxolan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111518861 |
| Molecular Formula | C22H41N7O |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-methylpiperidin-1-yl)propyl]-3-[1-(oxolan-2-yl)ethyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\CCCN1CCC(C)CC1)NC(C)C1CCCO1 |
| InChI | InChI=1S/C22H41N7O/c1-4-21-27-25-17-29(21)15-11-24-22(26-19(3)20-7-5-16-30-20)23-10-6-12-28-13-8-18(2)9-14-28/h17-20H,4-16H2,1-3H3,(H2,23,24,26) |
| InChIKey | MYHSOOWHLXFCHT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|