C20H30Cl2N6O — CID 111515731
1-[1-(3,4-dichlorophenyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111515731) has the molecular formula C20H30Cl2N6O and a molecular weight of 441.41 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111515731 |
| Molecular Formula | C20H30Cl2N6O |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCOCCC/N=C(\NCCn1cnnc1CC)NC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H30Cl2N6O/c1-4-19-27-25-14-28(19)11-10-24-20(23-9-6-12-29-5-2)26-15(3)16-7-8-17(21)18(22)13-16/h7-8,13-15H,4-6,9-12H2,1-3H3,(H2,23,24,26) |
| InChIKey | HZTAQTZLQHWIDS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|