C21H33FN6OS — CID 111515150
1-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine (PubChem CID 111515150) has the molecular formula C21H33FN6OS and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
|---|---|
| PubChem CID | 111515150 |
| Molecular Formula | C21H33FN6OS |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
| SMILES | CCOCCCN/C(=N\CCCSc1ccc(F)cc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C21H33FN6OS/c1-3-20-27-26-17-28(20)14-13-25-21(23-11-5-15-29-4-2)24-12-6-16-30-19-9-7-18(22)8-10-19/h7-10,17H,3-6,11-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | CPGBNFBUIDGRKB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|