C22H35ClIN7O — CID 111516924
1-[2-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111516924) has the molecular formula C22H35ClIN7O and a molecular weight of 575.93 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111516924 |
| Molecular Formula | C22H35ClIN7O |
| Molecular Weight | 575.93 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CCCN1CCOCC1)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C22H34ClN7O.HI/c1-2-21-28-27-18-30(21)12-10-26-22(24-8-4-11-29-13-15-31-16-14-29)25-9-7-19-5-3-6-20(23)17-19;/h3,5-6,17-18H,2,4,7-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | QDBYYPSHODSKBU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.93 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|