C19H37N7O — CID 111517412
2-[[(2-ethylhexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111517412) has the molecular formula C19H37N7O and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-ethylhexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111517412 |
| Molecular Formula | C19H37N7O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NCCn1cnnc1CC |
| InChI | InChI=1S/C19H37N7O/c1-6-9-10-16(7-2)13-21-19(22-14-18(27)25(4)5)20-11-12-26-15-23-24-17(26)8-3/h15-16H,6-14H2,1-5H3,(H2,20,21,22) |
| InChIKey | BPDKUNWTPJZPQO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|