C17H32IN7O — CID 111517381
2-[[(cyclohexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111517381) has the molecular formula C17H32IN7O and a molecular weight of 477.40 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclohexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111517381 |
| Molecular Formula | C17H32IN7O |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[[(cyclohexylamino)-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CC(=O)N(C)C)NC1CCCCC1.I |
| InChI | InChI=1S/C17H31N7O.HI/c1-4-15-22-20-13-24(15)11-10-18-17(19-12-16(25)23(2)3)21-14-8-6-5-7-9-14;/h13-14H,4-12H2,1-3H3,(H2,18,19,21);1H |
| InChIKey | YEGYDHGOKPHKOP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|