C17H30N6 — CID 111493162
1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine (PubChem CID 111493162) has the molecular formula C17H30N6 and a molecular weight of 318.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 111493162 |
| Molecular Formula | C17H30N6 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\NCCn1cnnc1CC)NC1CCCCC1 |
| InChI | InChI=1S/C17H30N6/c1-4-16-22-20-13-23(16)11-10-18-17(19-12-14(2)3)21-15-8-6-5-7-9-15/h13,15H,2,4-12H2,1,3H3,(H2,18,19,21) |
| InChIKey | QMQJPRMQVKBRGP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|