C18H28IN7 — CID 111511984
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111511984) has the molecular formula C18H28IN7 and a molecular weight of 469.38 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111511984 |
| Molecular Formula | C18H28IN7 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(/NCCc1ccccn1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C18H27N7.HI/c1-4-17-24-23-14-25(17)12-11-21-18(22-13-15(2)3)20-10-8-16-7-5-6-9-19-16;/h5-7,9,14H,2,4,8,10-13H2,1,3H3,(H2,20,21,22);1H |
| InChIKey | CIFSFSVLSNABDW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|