C19H29IN6S — CID 111518104
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111518104) has the molecular formula C19H29IN6S and a molecular weight of 500.45 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518104 |
| Molecular Formula | C19H29IN6S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(/NCCSc1ccccc1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C19H28N6S.HI/c1-4-18-24-23-15-25(18)12-10-20-19(22-14-16(2)3)21-11-13-26-17-8-6-5-7-9-17;/h5-9,15H,2,4,10-14H2,1,3H3,(H2,20,21,22);1H |
| InChIKey | ITHKRDBZZFSQKI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|