C17H27IN6S — CID 111518112
1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111518112) has the molecular formula C17H27IN6S and a molecular weight of 474.42 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518112 |
| Molecular Formula | C17H27IN6S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)NCCSc1ccccc1.I |
| InChI | InChI=1S/C17H26N6S.HI/c1-3-16-22-21-14-23(16)12-10-19-17(18-4-2)20-11-13-24-15-8-6-5-7-9-15;/h5-9,14H,3-4,10-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | KCGQJPLRXAFONP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|