C19H30N6O — CID 111700909
1-[2-(2,6-dimethylphenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111700909) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylphenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[2-(2,6-dimethylphenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111700909 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-[2-(2,6-dimethylphenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCn1cnnc1CC)NCCOc1c(C)cccc1C |
| InChI | InChI=1S/C19H30N6O/c1-5-17-24-23-14-25(17)12-10-21-19(20-6-2)22-11-13-26-18-15(3)8-7-9-16(18)4/h7-9,14H,5-6,10-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | JJYYDUMKXOAFPJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|