C17H26BrIN6O — CID 111698714
1-[2-(3-bromophenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111698714) has the molecular formula C17H26BrIN6O and a molecular weight of 537.24 g/mol. Its IUPAC name is 1-[2-(3-bromophenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-bromophenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111698714 |
| Molecular Formula | C17H26BrIN6O |
| Molecular Weight | 537.24 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 1-[2-(3-bromophenoxy)ethyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)NCCOc1cccc(Br)c1.I |
| InChI | InChI=1S/C17H25BrN6O.HI/c1-3-16-23-22-13-24(16)10-8-20-17(19-4-2)21-9-11-25-15-7-5-6-14(18)12-15;/h5-7,12-13H,3-4,8-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | VTSACYLQBKQDPS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|