C16H24ClIN6O — CID 111699558
1-[2-(3-chlorophenoxy)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111699558) has the molecular formula C16H24ClIN6O and a molecular weight of 478.77 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111699558 |
| Molecular Formula | C16H24ClIN6O |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCOc1cccc(Cl)c1.I |
| InChI | InChI=1S/C16H23ClN6O.HI/c1-3-15-22-21-12-23(15)9-7-19-16(18-2)20-8-10-24-14-6-4-5-13(17)11-14;/h4-6,11-12H,3,7-10H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | MONOVXQMOWYUGQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|