C21H36IN7O — CID 111698413
1-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111698413) has the molecular formula C21H36IN7O and a molecular weight of 529.47 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111698413 |
| Molecular Formula | C21H36IN7O |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 1-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCC(c1cccc(OC)c1)N(CC)CC.I |
| InChI | InChI=1S/C21H35N7O.HI/c1-6-20-26-25-16-28(20)13-12-23-21(22-4)24-15-19(27(7-2)8-3)17-10-9-11-18(14-17)29-5;/h9-11,14,16,19H,6-8,12-13,15H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | GVYXZNWFNNZLIX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|