C19H31N7O — CID 111701073
1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111701073) has the molecular formula C19H31N7O and a molecular weight of 373.51 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111701073 |
| Molecular Formula | C19H31N7O |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCC(c1cccc(OC)c1)N(C)C |
| InChI | InChI=1S/C19H31N7O/c1-6-18-24-23-14-26(18)11-10-21-19(20-2)22-13-17(25(3)4)15-8-7-9-16(12-15)27-5/h7-9,12,14,17H,6,10-11,13H2,1-5H3,(H2,20,21,22) |
| InChIKey | UDYOHWPURIBWGG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|