C14H27IN6 — CID 111510335
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-propan-2-ylguanidine;hydroiodide (PubChem CID 111510335) has the molecular formula C14H27IN6 and a molecular weight of 406.32 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-propan-2-ylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111510335 |
| Molecular Formula | C14H27IN6 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)-3-propan-2-ylguanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(/NCCn1cnnc1CC)NC(C)C.I |
| InChI | InChI=1S/C14H26N6.HI/c1-6-13-19-17-10-20(13)8-7-15-14(18-12(4)5)16-9-11(2)3;/h10,12H,2,6-9H2,1,3-5H3,(H2,15,16,18);1H |
| InChIKey | YAZLUAZIZLGMAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|