C20H40IN7 — CID 111509804
1-[5-(diethylamino)pentan-2-yl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111509804) has the molecular formula C20H40IN7 and a molecular weight of 505.49 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111509804 |
| Molecular Formula | C20H40IN7 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(/NCCn1cnnc1CC)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C20H39N7.HI/c1-7-19-25-23-16-27(19)14-12-21-20(22-15-17(4)5)24-18(6)11-10-13-26(8-2)9-3;/h16,18H,4,7-15H2,1-3,5-6H3,(H2,21,22,24);1H |
| InChIKey | DAGWPDFNOAMKPC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|