C17H35N7 — CID 110999307
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 110999307) has the molecular formula C17H35N7 and a molecular weight of 337.52 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 110999307 |
| Molecular Formula | C17H35N7 |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 337.30 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1CC)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C17H35N7/c1-6-18-17(19-13-16-22-20-14-24(16)9-4)21-15(5)11-10-12-23(7-2)8-3/h14-15H,6-13H2,1-5H3,(H2,18,19,21) |
| InChIKey | VFIXKJBOHRLMRH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|