C10H20N6 — CID 111126417
1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine (PubChem CID 111126417) has the molecular formula C10H20N6 and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine.
| Compound Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111126417 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NC(C)C |
| InChI | InChI=1S/C10H20N6/c1-5-11-10(14-8(2)3)12-6-9-15-13-7-16(9)4/h7-8H,5-6H2,1-4H3,(H2,11,12,14) |
| InChIKey | LMOOPTOEUDRVHQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|