C17H26N6 — CID 111648726
1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111648726) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111648726 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NCCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H26N6/c1-5-18-17(20-11-16-22-21-12-23(16)4)19-7-6-15-9-13(2)8-14(3)10-15/h8-10,12H,5-7,11H2,1-4H3,(H2,18,19,20) |
| InChIKey | IMIMRWXOFRHRGX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|