C13H26N6 — CID 111943751
1-ethyl-3-(4-methylpentyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111943751) has the molecular formula C13H26N6 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-ethyl-3-(4-methylpentyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(4-methylpentyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111943751 |
| Molecular Formula | C13H26N6 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 1-ethyl-3-(4-methylpentyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NCCCC(C)C |
| InChI | InChI=1S/C13H26N6/c1-5-14-13(15-8-6-7-11(2)3)16-9-12-18-17-10-19(12)4/h10-11H,5-9H2,1-4H3,(H2,14,15,16) |
| InChIKey | QZCBYWVOWIKPPB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|