C18H29N7 — CID 111390051
1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111390051) has the molecular formula C18H29N7 and a molecular weight of 343.48 g/mol. Its IUPAC name is 1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111390051 |
| Molecular Formula | C18H29N7 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 1-ethyl-3-[3-(N-ethylanilino)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NCCCN(CC)c1ccccc1 |
| InChI | InChI=1S/C18H29N7/c1-4-19-18(21-14-17-23-22-15-24(17)3)20-12-9-13-25(5-2)16-10-7-6-8-11-16/h6-8,10-11,15H,4-5,9,12-14H2,1-3H3,(H2,19,20,21) |
| InChIKey | ZSLOAKQXGFSHEQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|