C23H31N7 — CID 111330762
1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111330762) has the molecular formula C23H31N7 and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111330762 |
| Molecular Formula | C23H31N7 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1-c1ccccc1)NCCN(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C23H31N7/c1-4-24-23(25-14-15-29(5-2)21-13-9-10-19(3)16-21)26-17-22-28-27-18-30(22)20-11-7-6-8-12-20/h6-13,16,18H,4-5,14-15,17H2,1-3H3,(H2,24,25,26) |
| InChIKey | ZQZGPJMSTSCPFH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|