C15H21FN6 — CID 111395403
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111395403) has the molecular formula C15H21FN6 and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111395403 |
| Molecular Formula | C15H21FN6 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN6/c1-3-17-15(19-10-14-21-20-11-22(14)2)18-8-7-12-5-4-6-13(16)9-12/h4-6,9,11H,3,7-8,10H2,1-2H3,(H2,17,18,19) |
| InChIKey | VKTBWTYXKSJSNC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|