C22H27FN6O — CID 111870342
1-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111870342) has the molecular formula C22H27FN6O and a molecular weight of 410.50 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111870342 |
| Molecular Formula | C22H27FN6O |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(=N/Cc2nncn2C)NCCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H27FN6O/c1-16(2)30-20-9-7-19(8-10-20)27-22(25-14-21-28-26-15-29(21)3)24-12-11-17-5-4-6-18(23)13-17/h4-10,13,15-16H,11-12,14H2,1-3H3,(H2,24,25,27) |
| InChIKey | INCRGVKUBLSHRF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|