C24H40IN7O — CID 111867165
2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(4-methylpiperidin-1-yl)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111867165) has the molecular formula C24H40IN7O and a molecular weight of 569.54 g/mol. Its IUPAC name is 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(4-methylpiperidin-1-yl)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(4-methylpiperidin-1-yl)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111867165 |
| Molecular Formula | C24H40IN7O |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(4-methylpiperidin-1-yl)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CCn1cnnc1C/N=C(\NCCCN1CCC(C)CC1)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C24H39N7O.HI/c1-5-31-18-27-29-23(31)17-26-24(25-13-6-14-30-15-11-20(4)12-16-30)28-21-7-9-22(10-8-21)32-19(2)3;/h7-10,18-20H,5-6,11-17H2,1-4H3,(H2,25,26,28);1H |
| InChIKey | MQKQSHPETYYWFX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|