C24H33IN6O2 — CID 111875516
2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111875516) has the molecular formula C24H33IN6O2 and a molecular weight of 564.47 g/mol. Its IUPAC name is 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111875516 |
| Molecular Formula | C24H33IN6O2 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CCn1cnnc1C/N=C(\NCCCOc1ccccc1)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C24H32N6O2.HI/c1-4-30-18-27-29-23(30)17-26-24(25-15-8-16-31-21-9-6-5-7-10-21)28-20-11-13-22(14-12-20)32-19(2)3;/h5-7,9-14,18-19H,4,8,15-17H2,1-3H3,(H2,25,26,28);1H |
| InChIKey | CEJJVPPQSWBVOG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|