C20H33IN6O3 — CID 111872086
1-[3-(2-methoxyethoxy)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111872086) has the molecular formula C20H33IN6O3 and a molecular weight of 532.43 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111872086 |
| Molecular Formula | C20H33IN6O3 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | COCCOCCCN/C(=N\Cc1nncn1C)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C20H32N6O3.HI/c1-16(2)29-18-8-6-17(7-9-18)24-20(21-10-5-11-28-13-12-27-4)22-14-19-25-23-15-26(19)3;/h6-9,15-16H,5,10-14H2,1-4H3,(H2,21,22,24);1H |
| InChIKey | XWPPEVWTQHLWIO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|