C21H34IN5O3 — CID 111871872
1-[3-(2-methoxyethoxy)propyl]-2-[(1-methylpyrazol-4-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111871872) has the molecular formula C21H34IN5O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-[(1-methylpyrazol-4-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-[(1-methylpyrazol-4-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871872 |
| Molecular Formula | C21H34IN5O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-[(1-methylpyrazol-4-yl)methyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | COCCOCCCN/C(=N\Cc1cnn(C)c1)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C21H33N5O3.HI/c1-17(2)29-20-8-6-19(7-9-20)25-21(22-10-5-11-28-13-12-27-4)23-14-18-15-24-26(3)16-18;/h6-9,15-17H,5,10-14H2,1-4H3,(H2,22,23,25);1H |
| InChIKey | BWQCXYKHZJSTLG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|