C22H32IN5O3S — CID 111871840
2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111871840) has the molecular formula C22H32IN5O3S and a molecular weight of 573.50 g/mol. Its IUPAC name is 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871840 |
| Molecular Formula | C22H32IN5O3S |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | COCCOCCCN/C(=N\Cc1cn2ccsc2n1)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C22H31N5O3S.HI/c1-17(2)30-20-7-5-18(6-8-20)25-21(23-9-4-11-29-13-12-28-3)24-15-19-16-27-10-14-31-22(27)26-19;/h5-8,10,14,16-17H,4,9,11-13,15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | YEKHQSSCTNKSAJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|