C22H26IN5O2S — CID 111861994
1-[2-(furan-2-yl)ethyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111861994) has the molecular formula C22H26IN5O2S and a molecular weight of 551.45 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111861994 |
| Molecular Formula | C22H26IN5O2S |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(=N/Cc2cn3ccsc3n2)NCCc2ccco2)cc1.I |
| InChI | InChI=1S/C22H25N5O2S.HI/c1-16(2)29-20-7-5-17(6-8-20)25-21(23-10-9-19-4-3-12-28-19)24-14-18-15-27-11-13-30-22(27)26-18;/h3-8,11-13,15-16H,9-10,14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | PHWIWNZLZLTSPY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|