C18H23FIN5OS — CID 111681047
1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide (PubChem CID 111681047) has the molecular formula C18H23FIN5OS and a molecular weight of 503.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111681047 |
| Molecular Formula | C18H23FIN5OS |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenoxy)propyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCC(C)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C18H22FN5OS.HI/c1-3-20-17(22-11-15-12-24-7-8-26-18(24)23-15)21-10-13(2)25-16-6-4-5-14(19)9-16;/h4-9,12-13H,3,10-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | XLVOJUXRVYETKX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|