C19H26IN5O2S — CID 111682321
1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide (PubChem CID 111682321) has the molecular formula C19H26IN5O2S and a molecular weight of 515.42 g/mol. Its IUPAC name is 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111682321 |
| Molecular Formula | C19H26IN5O2S |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-(2-methoxyphenoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCC(C)Oc1ccccc1OC.I |
| InChI | InChI=1S/C19H25N5O2S.HI/c1-4-20-18(22-12-15-13-24-9-10-27-19(24)23-15)21-11-14(2)26-17-8-6-5-7-16(17)25-3;/h5-10,13-14H,4,11-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | ZSXOXYMQMVMMPD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|